CAS 84019-17-0 appears in our catalog under these names: 5,6–Dihydroxy–3,7,4'–trimethoxyflavone, Tanetin. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, Get quote.
5,6-dihydroxy-3,7-dimethoxy-2-(4-methoxyphenyl)chromen-4-one (CAS 84019-17-0) is a chemical compound with the molecular formula C18H16O7 and a molecular weight of 344.3 g/mol. IUPAC name: 5,6-dihydroxy-3,7-dimethoxy-2-(4-methoxyphenyl)chromen-4-one. InChIKey: OIQSGZWRLLAFNQ-UHFFFAOYSA-N.
| Molecular formula | C18H16O7 |
|---|---|
| Molecular weight | 344.3 g/mol |
| IUPAC name | 5,6-dihydroxy-3,7-dimethoxy-2-(4-methoxyphenyl)chromen-4-one |
| InChIKey | OIQSGZWRLLAFNQ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C(=O)C3=C(C(=C(C=C3O2)OC)O)O)OC |
Computed by PubChem (NCBI)