CAS 433324-06-2 is the registry number for 2-((4-(N-(3,5-Dimethylphenyl)sulfamoyl)phenyl)carbamoyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]carbamoyl]benzoic acid (CAS 433324-06-2) is a chemical compound with the molecular formula C22H20N2O5S and a molecular weight of 424.5 g/mol. IUPAC name: 2-[[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]carbamoyl]benzoic acid. InChIKey: PDLDXOHXMAXKON-UHFFFAOYSA-N.
| Molecular formula | C22H20N2O5S |
|---|---|
| Molecular weight | 424.5 g/mol |
| IUPAC name | 2-[[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]carbamoyl]benzoic acid |
| InChIKey | PDLDXOHXMAXKON-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)NS(=O)(=O)C2=CC=C(C=C2)NC(=O)C3=CC=CC=C3C(=O)O)C |
Computed by PubChem (NCBI)