Products 606924-86-1

CAS 606924-86-1 is the registry number for 2-((4-(N-(3,4-Dimethylphenyl)sulfamoyl)phenyl)carbamoyl)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]carbamoyl]benzoic acid (CAS 606924-86-1) is a chemical compound with the molecular formula C22H20N2O5S and a molecular weight of 424.5 g/mol. IUPAC name: 2-[[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]carbamoyl]benzoic acid. InChIKey: MJXOVQSRLNNIKX-UHFFFAOYSA-N.

Identity
Molecular formulaC22H20N2O5S
Molecular weight424.5 g/mol
IUPAC name2-[[4-[(3,4-dimethylphenyl)sulfamoyl]phenyl]carbamoyl]benzoic acid
InChIKeyMJXOVQSRLNNIKX-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)NC(=O)C3=CC=CC=C3C(=O)O)C

Computed by PubChem (NCBI)