Products 497090-01-4

CAS 497090-01-4 is the registry number for 2-((4-(N-Benzyl-N-methylsulfamoyl)phenyl)carbamoyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[[4-[benzyl(methyl)sulfamoyl]phenyl]carbamoyl]benzoic acid (CAS 497090-01-4) is a chemical compound with the molecular formula C22H20N2O5S and a molecular weight of 424.5 g/mol. IUPAC name: 2-[[4-[benzyl(methyl)sulfamoyl]phenyl]carbamoyl]benzoic acid. InChIKey: YYJVVAWTTNUYHN-UHFFFAOYSA-N.

Identity
Molecular formulaC22H20N2O5S
Molecular weight424.5 g/mol
IUPAC name2-[[4-[benzyl(methyl)sulfamoyl]phenyl]carbamoyl]benzoic acid
InChIKeyYYJVVAWTTNUYHN-UHFFFAOYSA-N
SMILESCN(CC1=CC=CC=C1)S(=O)(=O)C2=CC=C(C=C2)NC(=O)C3=CC=CC=C3C(=O)O

Computed by PubChem (NCBI)