CAS 433920-92-4 is the registry number for 4-(Pyrimidin-2-yloxy)benzaldehyde, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g.
4-pyrimidin-2-yloxybenzaldehyde (CAS 433920-92-4) is a chemical compound with the molecular formula C11H8N2O2 and a molecular weight of 200.19 g/mol. IUPAC name: 4-pyrimidin-2-yloxybenzaldehyde. InChIKey: CGSRJSIAGKSMHU-UHFFFAOYSA-N.
| Molecular formula | C11H8N2O2 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 4-pyrimidin-2-yloxybenzaldehyde |
| InChIKey | CGSRJSIAGKSMHU-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)OC2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)