CAS 4363-04-6 appears in our catalog under these names: 6-Amino-2-naphthol, 6-Aminonaphthalen-2-ol 95%, 6-Aminonaphthalen-2-Ol, 95%, 95%. Offered by: Chemat Brand, Ambeed, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g, 5g.
6-aminonaphthalen-2-ol (CAS 4363-04-6) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 6-aminonaphthalen-2-ol. InChIKey: SERBLGFKBWPCJD-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 6-aminonaphthalen-2-ol |
| InChIKey | SERBLGFKBWPCJD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)O)C=C1N |
Computed by PubChem (NCBI)