Products 4394-05-2
CAS 4394-05-2 appears in our catalog under these names: 2-((2,3-Dimethylphenyl)amino)nicotinic acid, 97%, Nixylic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 1g.
2-(2,3-dimethylanilino)pyridine-3-carboxylic acid (CAS 4394-05-2) is a chemical compound with the molecular formula C14H14N2O2 and a molecular weight of 242.27 g/mol. IUPAC name: 2-(2,3-dimethylanilino)pyridine-3-carboxylic acid. InChIKey: XEQIPELDMSEBJG-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O2 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | 2-(2,3-dimethylanilino)pyridine-3-carboxylic acid |
| InChIKey | XEQIPELDMSEBJG-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)NC2=C(C=CC=N2)C(=O)O)C |
Computed by PubChem (NCBI)
Synonyms:
Nixylic acid, 2-(2,3-dimethylanilino)pyridine-3-carboxylic acid, Acide nixylique, Acido nixilico, 2-((2,3-dimethylphenyl)amino)nicotinic acid, 2-[(2,3-Dimethylphenyl)amino]nicotinic acid, 2-[(2,3-dimethylphenyl)amino]pyridine-3-carboxylic acid, 2-(2,3-Xylidino)nicotinic acid, 3-Pyridinecarboxylic acid, 2-[(2,3-dimethylphenyl)amino]-, 2-(2,3-Dimethyl-phenylamino)-nicotinic acid