CAS 439591-67-0 appears in our catalog under these names: Ropivacaine Impurity 10, N-(3,5-Dimethylphenyl)picolinamide, 97%. Offered by: Hubei YoungXin, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
N-(3,5-dimethylphenyl)pyridine-2-carboxamide (CAS 439591-67-0) is a chemical compound with the molecular formula C14H14N2O and a molecular weight of 226.27 g/mol. IUPAC name: N-(3,5-dimethylphenyl)pyridine-2-carboxamide. InChIKey: UIMFXMRZPJGDHP-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | N-(3,5-dimethylphenyl)pyridine-2-carboxamide |
| InChIKey | UIMFXMRZPJGDHP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)NC(=O)C2=CC=CC=N2)C |
Computed by PubChem (NCBI)