CAS 4397-53-9 appears in our catalog under these names: 4-Benzyloxybenzaldehyde, 98%, Ibuprofen Impurity 29, 4-Benzyloxybenzaldehyde, 4–Benzyloxybenzaldehyde, 4-(Benzyloxy)benzaldehyde 97%. Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Biosynth. Available pack sizes: 100g, 1kg, 25g, 500g, 5g, on request, 250g, 0,025kg.
4-phenylmethoxybenzaldehyde (CAS 4397-53-9) is a chemical compound with the molecular formula C14H12O2 and a molecular weight of 212.24 g/mol. IUPAC name: 4-phenylmethoxybenzaldehyde. InChIKey: ZVTWZSXLLMNMQC-UHFFFAOYSA-N.
| Molecular formula | C14H12O2 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | 4-phenylmethoxybenzaldehyde |
| InChIKey | ZVTWZSXLLMNMQC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C=O |
Computed by PubChem (NCBI)