CAS 439858-38-5 appears in our catalog under these names: 1-Acetoxy-3-methoxycarbonyl-2,2,5,5-tetramethylpyrrolidine, 98%, 1-Acetoxy-3-methoxycarbonyl-2,2,5,5-tetramethylpyrrolidine, AMCPy. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 100mg, Get quote.
Methyl 1-acetyloxy-2,2,5,5-tetramethylpyrrolidine-3-carboxylate (CAS 439858-38-5) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: methyl 1-acetyloxy-2,2,5,5-tetramethylpyrrolidine-3-carboxylate. InChIKey: KSWKLBFXRCFELO-UHFFFAOYSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | methyl 1-acetyloxy-2,2,5,5-tetramethylpyrrolidine-3-carboxylate |
| InChIKey | KSWKLBFXRCFELO-UHFFFAOYSA-N |
| SMILES | CC(=O)ON1C(CC(C1(C)C)C(=O)OC)(C)C |
Computed by PubChem (NCBI)