CAS 442124-92-7 appears in our catalog under these names: 2-(Methylsulfonyl)nicotinic acid, 95%, 95%, 2-METHANESULFONYLPYRIDINE-3-CARBOXYLIC ACID, 95%, 2-(Methylsulfonyl)nicotinic acid, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-methylsulfonylpyridine-3-carboxylic acid (CAS 442124-92-7) is a chemical compound with the molecular formula C7H7NO4S and a molecular weight of 201.20 g/mol. IUPAC name: 2-methylsulfonylpyridine-3-carboxylic acid. InChIKey: ISOWZOJTYNRCSL-UHFFFAOYSA-N.
| Molecular formula | C7H7NO4S |
|---|---|
| Molecular weight | 201.20 g/mol |
| IUPAC name | 2-methylsulfonylpyridine-3-carboxylic acid |
| InChIKey | ISOWZOJTYNRCSL-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(C=CC=N1)C(=O)O |
Computed by PubChem (NCBI)