CAS 4422-70-2 is the registry number for 2-(2-Phenylethenyl)-1,3-dioxolane-4-methanol. Offered by: TRC. Available pack sizes: 1g.
[2-[(E)-2-phenylethenyl]-1,3-dioxolan-4-yl]methanol (CAS 4422-70-2) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: [2-[(E)-2-phenylethenyl]-1,3-dioxolan-4-yl]methanol. InChIKey: MXYJBWOKBNEFHH-VOTSOKGWSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | [2-[(E)-2-phenylethenyl]-1,3-dioxolan-4-yl]methanol |
| InChIKey | MXYJBWOKBNEFHH-VOTSOKGWSA-N |
| SMILES | C1C(OC(O1)/C=C/C2=CC=CC=C2)CO |
Computed by PubChem (NCBI)