CAS 443125-98-2 appears in our catalog under these names: 5-Bromo-2-[(3,4-dichlorobenzyl)oxy]benzaldehyde, 95%, 5-Bromo-2-((3,4-dichlorobenzyl)oxy)benzaldehyde, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
5-bromo-2-[(3,4-dichlorophenyl)methoxy]benzaldehyde (CAS 443125-98-2) is a chemical compound with the molecular formula C14H9BrCl2O2 and a molecular weight of 360.0 g/mol. IUPAC name: 5-bromo-2-[(3,4-dichlorophenyl)methoxy]benzaldehyde. InChIKey: PWVKPFOSNRCOIU-UHFFFAOYSA-N.
| Molecular formula | C14H9BrCl2O2 |
|---|---|
| Molecular weight | 360.0 g/mol |
| IUPAC name | 5-bromo-2-[(3,4-dichlorophenyl)methoxy]benzaldehyde |
| InChIKey | PWVKPFOSNRCOIU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1COC2=C(C=C(C=C2)Br)C=O)Cl)Cl |
Computed by PubChem (NCBI)