CAS 591210-39-8 is the registry number for 3-Bromo-4-((3,4-dichlorobenzyl)oxy)benzaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-bromo-4-[(3,4-dichlorophenyl)methoxy]benzaldehyde (CAS 591210-39-8) is a chemical compound with the molecular formula C14H9BrCl2O2 and a molecular weight of 360.0 g/mol. IUPAC name: 3-bromo-4-[(3,4-dichlorophenyl)methoxy]benzaldehyde. InChIKey: QVQZCSALKZJGPM-UHFFFAOYSA-N.
| Molecular formula | C14H9BrCl2O2 |
|---|---|
| Molecular weight | 360.0 g/mol |
| IUPAC name | 3-bromo-4-[(3,4-dichlorophenyl)methoxy]benzaldehyde |
| InChIKey | QVQZCSALKZJGPM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1COC2=C(C=C(C=C2)C=O)Br)Cl)Cl |
Computed by PubChem (NCBI)