Products 906005-51-4
CAS 906005-51-4 is the registry number for 2-Bromo-2'-chloro-4'-(4-chlorophenoxy)acetophenone. Offered by: TRC. Available pack sizes: 2,5g.
2-bromo-1-[2-chloro-4-(4-chlorophenoxy)phenyl]ethanone (CAS 906005-51-4) is a chemical compound with the molecular formula C14H9BrCl2O2 and a molecular weight of 360.0 g/mol. IUPAC name: 2-bromo-1-[2-chloro-4-(4-chlorophenoxy)phenyl]ethanone. InChIKey: OQBGLIOEWKCXNF-UHFFFAOYSA-N.
| Molecular formula | C14H9BrCl2O2 |
|---|---|
| Molecular weight | 360.0 g/mol |
| IUPAC name | 2-bromo-1-[2-chloro-4-(4-chlorophenoxy)phenyl]ethanone |
| InChIKey | OQBGLIOEWKCXNF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC2=CC(=C(C=C2)C(=O)CBr)Cl)Cl |
Computed by PubChem (NCBI)