Products 444002-88-4
CAS 444002-88-4 is the registry number for 1-(4-Amino-2-chlorophenyl)pyrrolidin-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(4-amino-2-chlorophenyl)pyrrolidin-2-one (CAS 444002-88-4) is a chemical compound with the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. IUPAC name: 1-(4-amino-2-chlorophenyl)pyrrolidin-2-one. InChIKey: HFOLSRFQZMMEAA-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN2O |
|---|---|
| Molecular weight | 210.66 g/mol |
| IUPAC name | 1-(4-amino-2-chlorophenyl)pyrrolidin-2-one |
| InChIKey | HFOLSRFQZMMEAA-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1)C2=C(C=C(C=C2)N)Cl |
Computed by PubChem (NCBI)