Products 444020-69-3
CAS 444020-69-3 appears in our catalog under these names: 3’-Deoxy-3’-α-C-methylguanosine, 3’-Deoxy- 3'- methylguanosine. Offered by: MedChemExpress, Biosynth. Available pack sizes: Get quote, 25mg, 10mg.
2-amino-9-[(2R,3R,4S,5S)-3-hydroxy-5-(hydroxymethyl)-4-methyloxolan-2-yl]-1H-purin-6-one (CAS 444020-69-3) is a chemical compound with the molecular formula C11H15N5O4 and a molecular weight of 281.27 g/mol. IUPAC name: 2-amino-9-[(2R,3R,4S,5S)-3-hydroxy-5-(hydroxymethyl)-4-methyloxolan-2-yl]-1H-purin-6-one. InChIKey: MIMRHFMVVSLFRL-QYYRPYCUSA-N.
| Molecular formula | C11H15N5O4 |
|---|---|
| Molecular weight | 281.27 g/mol |
| IUPAC name | 2-amino-9-[(2R,3R,4S,5S)-3-hydroxy-5-(hydroxymethyl)-4-methyloxolan-2-yl]-1H-purin-6-one |
| InChIKey | MIMRHFMVVSLFRL-QYYRPYCUSA-N |
| SMILES | C[C@@H]1[C@H](O[C@H]([C@@H]1O)N2C=NC3=C2N=C(NC3=O)N)CO |
Computed by PubChem (NCBI)