Products 444064-49-7
CAS 444064-49-7 is the registry number for ethyl 2-nitrilo-3-(3-phenoxyphenyl)prop-2-enoate. Offered by: Biosynth. Available pack sizes: 250mg.
Ethyl (E)-2-cyano-3-(3-phenoxyphenyl)prop-2-enoate (CAS 444064-49-7) is a chemical compound with the molecular formula C18H15NO3 and a molecular weight of 293.3 g/mol. IUPAC name: ethyl (E)-2-cyano-3-(3-phenoxyphenyl)prop-2-enoate. InChIKey: HUIIAGDFTJLEAY-RVDMUPIBSA-N.
| Molecular formula | C18H15NO3 |
|---|---|
| Molecular weight | 293.3 g/mol |
| IUPAC name | ethyl (E)-2-cyano-3-(3-phenoxyphenyl)prop-2-enoate |
| InChIKey | HUIIAGDFTJLEAY-RVDMUPIBSA-N |
| SMILES | CCOC(=O)/C(=C/C1=CC(=CC=C1)OC2=CC=CC=C2)/C#N |
Computed by PubChem (NCBI)