Products 4442-72-2

CAS 4442-72-2 is the registry number for 2-(2-Methyl-1,3-dioxaindan-2-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-(2-methyl-1,3-benzodioxol-2-yl)acetic acid (CAS 4442-72-2) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: 2-(2-methyl-1,3-benzodioxol-2-yl)acetic acid. InChIKey: KBBSSMZKVMEGDK-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10O4
Molecular weight194.18 g/mol
IUPAC name2-(2-methyl-1,3-benzodioxol-2-yl)acetic acid
InChIKeyKBBSSMZKVMEGDK-UHFFFAOYSA-N
SMILESCC1(OC2=CC=CC=C2O1)CC(=O)O

Computed by PubChem (NCBI)