CAS 445041-66-7 appears in our catalog under these names: 2-Chloro-7-iodoquinoline, 97%, 2-Chloro-7-iodoquinoline, 95%, 2-Chloro-7-iodoquinoline, 95%, 95%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg.
2-chloro-7-iodoquinoline (CAS 445041-66-7) is a chemical compound with the molecular formula C9H5ClIN and a molecular weight of 289.50 g/mol. IUPAC name: 2-chloro-7-iodoquinoline. InChIKey: JPUNFKVZAKYYLN-UHFFFAOYSA-N.
| Molecular formula | C9H5ClIN |
|---|---|
| Molecular weight | 289.50 g/mol |
| IUPAC name | 2-chloro-7-iodoquinoline |
| InChIKey | JPUNFKVZAKYYLN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=N2)Cl)I |
Computed by PubChem (NCBI)