Products 4463-79-0
CAS 4463-79-0 is the registry number for 3,3',5,5'-Tetrabromo-[1,1'-biphenyl]-4,4'-diol, 98%. Offered by: Fluorochem. Available pack sizes: 500mg, 1g.
2,6-dibromo-4-(3,5-dibromo-4-hydroxyphenyl)phenol (CAS 4463-79-0) is a chemical compound with the molecular formula C12H6Br4O2 and a molecular weight of 501.79 g/mol. IUPAC name: 2,6-dibromo-4-(3,5-dibromo-4-hydroxyphenyl)phenol. InChIKey: IEAGIQDVKKVLEI-UHFFFAOYSA-N.
| Molecular formula | C12H6Br4O2 |
|---|---|
| Molecular weight | 501.79 g/mol |
| IUPAC name | 2,6-dibromo-4-(3,5-dibromo-4-hydroxyphenyl)phenol |
| InChIKey | IEAGIQDVKKVLEI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)O)Br)C2=CC(=C(C(=C2)Br)O)Br |
Computed by PubChem (NCBI)