Products 44742-89-4
CAS 44742-89-4 is the registry number for Ammonium hydrogen maleate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Azanium (Z)-4-hydroxy-4-oxobut-2-enoate (CAS 44742-89-4) is a chemical compound with the molecular formula C4H7NO4 and a molecular weight of 133.10 g/mol. IUPAC name: azanium (Z)-4-hydroxy-4-oxobut-2-enoate. InChIKey: NLVWBYNKMPGKRG-ODZAUARKSA-N.
| Molecular formula | C4H7NO4 |
|---|---|
| Molecular weight | 133.10 g/mol |
| IUPAC name | azanium (Z)-4-hydroxy-4-oxobut-2-enoate |
| InChIKey | NLVWBYNKMPGKRG-ODZAUARKSA-N |
| SMILES | C(=C\C(=O)[O-])\C(=O)O.[NH4+] |
Computed by PubChem (NCBI)