CAS 202326-56-5 appears in our catalog under these names: DL-Aspartic acid-3-13C, 98% 98%atom%13C, DL–Aspartic acid–3–13C, DL-ASPARTIC-3-13C ACID, 99 ATOM % 13C, DL-Aspartic acid-3-13C. Offered by: Chemat Brand, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: on request, 25mg, 50mg, 250MG, 1 mg.
2-amino(313C)butanedioic acid (CAS 202326-56-5) is a chemical compound with the molecular formula C4H7NO4 and a molecular weight of 134.10 g/mol. IUPAC name: 2-amino(313C)butanedioic acid. InChIKey: CKLJMWTZIZZHCS-OUBTZVSYSA-N.
| Molecular formula | C4H7NO4 |
|---|---|
| Molecular weight | 134.10 g/mol |
| IUPAC name | 2-amino(313C)butanedioic acid |
| InChIKey | CKLJMWTZIZZHCS-OUBTZVSYSA-N |
| SMILES | [13CH2](C(C(=O)O)N)C(=O)O |
Computed by PubChem (NCBI)