CAS 81201-98-1 appears in our catalog under these names: L-aspartic-4-13cacid, 98% 98%atom%13C, L-ASPARTIC-4-13C ACID, 99 ATOM % 13C, L-Aspartic acid-13C-2. Offered by: Chemat Brand, Sigma-Aldrich, MedChemExpress. Available pack sizes: on request, 100MG, Get quote.
(2S)-2-amino(413C)butanedioic acid (CAS 81201-98-1) is a chemical compound with the molecular formula C4H7NO4 and a molecular weight of 134.10 g/mol. IUPAC name: (2S)-2-amino(413C)butanedioic acid. InChIKey: CKLJMWTZIZZHCS-NSQKCYGPSA-N.
| Molecular formula | C4H7NO4 |
|---|---|
| Molecular weight | 134.10 g/mol |
| IUPAC name | (2S)-2-amino(413C)butanedioic acid |
| InChIKey | CKLJMWTZIZZHCS-NSQKCYGPSA-N |
| SMILES | C([C@@H](C(=O)O)N)[13C](=O)O |
Computed by PubChem (NCBI)