Products 447460-43-7
CAS 447460-43-7 is the registry number for 2,6-Difluorobenzenesulfonyl fluoride, 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2,6-difluorobenzenesulfonyl fluoride (CAS 447460-43-7) is a chemical compound with the molecular formula C6H3F3O2S and a molecular weight of 196.15 g/mol. IUPAC name: 2,6-difluorobenzenesulfonyl fluoride. InChIKey: UHYYSDVSOOPZMT-UHFFFAOYSA-N.
| Molecular formula | C6H3F3O2S |
|---|---|
| Molecular weight | 196.15 g/mol |
| IUPAC name | 2,6-difluorobenzenesulfonyl fluoride |
| InChIKey | UHYYSDVSOOPZMT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)S(=O)(=O)F)F |
Computed by PubChem (NCBI)