CAS 767337-60-0 appears in our catalog under these names: 4-(Trifluoromethyl)thiophene-3-carboxylic acid, 98%, 4-(Trifluoromethyl)thiophene-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
4-(trifluoromethyl)thiophene-3-carboxylic acid (CAS 767337-60-0) is a chemical compound with the molecular formula C6H3F3O2S and a molecular weight of 196.15 g/mol. IUPAC name: 4-(trifluoromethyl)thiophene-3-carboxylic acid. InChIKey: VSTOPVQRSBFSLL-UHFFFAOYSA-N.
| Molecular formula | C6H3F3O2S |
|---|---|
| Molecular weight | 196.15 g/mol |
| IUPAC name | 4-(trifluoromethyl)thiophene-3-carboxylic acid |
| InChIKey | VSTOPVQRSBFSLL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CS1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)