CAS 4476-28-2 appears in our catalog under these names: 2–(4–Isopropylphenyl)acetic acid, 2-(4-Isopropylphenyl)acetic acid 98%, 2-(4-Isopropylphenyl)acetic acid, 97%, 2-(4-Isopropylphenyl)acetic acid, 98%, 98%, 4-Isopropylphenylacetic Acid. Offered by: GLPBio, Ambeed, Fluorochem, Chemat, TRC. Available pack sizes: 100g, 10g, 25g, 5g, 250mg, 1g, 100mg, 500mg.
2-(4-propan-2-ylphenyl)acetic acid (CAS 4476-28-2) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: 2-(4-propan-2-ylphenyl)acetic acid. InChIKey: RERBQXVRXYCGLT-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 2-(4-propan-2-ylphenyl)acetic acid |
| InChIKey | RERBQXVRXYCGLT-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)CC(=O)O |
Computed by PubChem (NCBI)