CAS 449211-79-4 appears in our catalog under these names: 2-(4-Chloromethyl-phenyl)-2h-[1,2,3]triazole, 95%, 2-(4-(Chloromethyl)phenyl)-2H-1,2,3-triazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
2-[4-(chloromethyl)phenyl]triazole (CAS 449211-79-4) is a chemical compound with the molecular formula C9H8ClN3 and a molecular weight of 193.63 g/mol. IUPAC name: 2-[4-(chloromethyl)phenyl]triazole. InChIKey: ISPMNMMLLQDSDT-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3 |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | 2-[4-(chloromethyl)phenyl]triazole |
| InChIKey | ISPMNMMLLQDSDT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCl)N2N=CC=N2 |
Computed by PubChem (NCBI)