CAS 449758-68-3 appears in our catalog under these names: Rac-(3s)-1-(tert-butoxycarbonyl)-3-methyl-l-proline, 96%, trans-1-(tert-Butoxycarbonyl)-3-methylpyrrolidine-2-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
(2S,3S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 449758-68-3) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: (2S,3S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: HBXAVWDHOQFJAH-YUMQZZPRSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | (2S,3S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | HBXAVWDHOQFJAH-YUMQZZPRSA-N |
| SMILES | C[C@H]1CCN([C@@H]1C(=O)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)