CAS 449758-72-9 is the registry number for (2R,3S)-1-tert-Butoxycarbonyl-3-methyl-pyrrolidine-2-carboxylic acid, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg.
(2R,3S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 449758-72-9) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: (2R,3S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: HBXAVWDHOQFJAH-JGVFFNPUSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | (2R,3S)-3-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | HBXAVWDHOQFJAH-JGVFFNPUSA-N |
| SMILES | C[C@H]1CCN([C@H]1C(=O)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)