CAS 450357-73-0 is the registry number for Methyl 6-methoxy-3-nitro-2-pyridineacetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2-(6-methoxy-3-nitro-2-pyridinyl)acetate (CAS 450357-73-0) is a chemical compound with the molecular formula C9H10N2O5 and a molecular weight of 226.19 g/mol. IUPAC name: methyl 2-(6-methoxy-3-nitro-2-pyridinyl)acetate. InChIKey: UIZBUPGVDORULK-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O5 |
|---|---|
| Molecular weight | 226.19 g/mol |
| IUPAC name | methyl 2-(6-methoxy-3-nitro-2-pyridinyl)acetate |
| InChIKey | UIZBUPGVDORULK-UHFFFAOYSA-N |
| SMILES | COC1=NC(=C(C=C1)[N+](=O)[O-])CC(=O)OC |
Computed by PubChem (NCBI)