Products 451459-92-0
CAS 451459-92-0 is the registry number for 2-(4-Methylpiperazin-1-yl)-5-nitrobenzonitrile, 95%. Offered by: Fluorochem. Available pack sizes: 1g.
2-(4-methylpiperazin-1-yl)-5-nitrobenzonitrile (CAS 451459-92-0) is a chemical compound with the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. IUPAC name: 2-(4-methylpiperazin-1-yl)-5-nitrobenzonitrile. InChIKey: LFOKDMGRKXOPEC-UHFFFAOYSA-N.
| Molecular formula | C12H14N4O2 |
|---|---|
| Molecular weight | 246.27 g/mol |
| IUPAC name | 2-(4-methylpiperazin-1-yl)-5-nitrobenzonitrile |
| InChIKey | LFOKDMGRKXOPEC-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C=C(C=C2)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)