Products 452088-71-0

CAS 452088-71-0 is the registry number for 1-(2,4-Dimethylphenyl)-2-methyl-1h-benzimidazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(2,4-dimethylphenyl)-2-methylbenzimidazole-5-carboxylic acid (CAS 452088-71-0) is a chemical compound with the molecular formula C17H16N2O2 and a molecular weight of 280.32 g/mol. IUPAC name: 1-(2,4-dimethylphenyl)-2-methylbenzimidazole-5-carboxylic acid. InChIKey: NFKMFKQSSTZBMA-UHFFFAOYSA-N.

Identity
Molecular formulaC17H16N2O2
Molecular weight280.32 g/mol
IUPAC name1-(2,4-dimethylphenyl)-2-methylbenzimidazole-5-carboxylic acid
InChIKeyNFKMFKQSSTZBMA-UHFFFAOYSA-N
SMILESCC1=CC(=C(C=C1)N2C(=NC3=C2C=CC(=C3)C(=O)O)C)C

Computed by PubChem (NCBI)