CAS 453576-43-7 is the registry number for N-Benzyl-2-chloro-N-(1,1-dioxidotetrahydrothiophen-3-yl)acetamide, 98%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
N-benzyl-2-chloro-N-(1,1-dioxothiolan-3-yl)acetamide (CAS 453576-43-7) is a chemical compound with the molecular formula C13H16ClNO3S and a molecular weight of 301.79 g/mol. IUPAC name: N-benzyl-2-chloro-N-(1,1-dioxothiolan-3-yl)acetamide. InChIKey: AFXOINVVLIRMFU-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO3S |
|---|---|
| Molecular weight | 301.79 g/mol |
| IUPAC name | N-benzyl-2-chloro-N-(1,1-dioxothiolan-3-yl)acetamide |
| InChIKey | AFXOINVVLIRMFU-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1N(CC2=CC=CC=C2)C(=O)CCl |
Computed by PubChem (NCBI)