CAS 890592-48-0 is the registry number for 4-(Azepan-1-ylsulfonyl)benzoyl chloride, 95%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
4-(azepan-1-ylsulfonyl)benzoyl chloride (CAS 890592-48-0) is a chemical compound with the molecular formula C13H16ClNO3S and a molecular weight of 301.79 g/mol. IUPAC name: 4-(azepan-1-ylsulfonyl)benzoyl chloride. InChIKey: RBMVCZXBPXRLFB-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO3S |
|---|---|
| Molecular weight | 301.79 g/mol |
| IUPAC name | 4-(azepan-1-ylsulfonyl)benzoyl chloride |
| InChIKey | RBMVCZXBPXRLFB-UHFFFAOYSA-N |
| SMILES | C1CCCN(CC1)S(=O)(=O)C2=CC=C(C=C2)C(=O)Cl |
Computed by PubChem (NCBI)