CAS 731012-07-0 is the registry number for Methyl 2-[(2-chloropropanoyl)amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-(2-chloropropanoylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (CAS 731012-07-0) is a chemical compound with the molecular formula C13H16ClNO3S and a molecular weight of 301.79 g/mol. IUPAC name: methyl 2-(2-chloropropanoylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate. InChIKey: UXOYXLFFOHUVJG-UHFFFAOYSA-N.
| Molecular formula | C13H16ClNO3S |
|---|---|
| Molecular weight | 301.79 g/mol |
| IUPAC name | methyl 2-(2-chloropropanoylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| InChIKey | UXOYXLFFOHUVJG-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NC1=C(C2=C(S1)CCCC2)C(=O)OC)Cl |
Computed by PubChem (NCBI)