CAS 454473-71-3 is the registry number for 3-Chloro-n-(3,5-dimethoxyphenyl)-2,2-dimethylpropanamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
3-chloro-N-(3,5-dimethoxyphenyl)-2,2-dimethylpropanamide (CAS 454473-71-3) is a chemical compound with the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. IUPAC name: 3-chloro-N-(3,5-dimethoxyphenyl)-2,2-dimethylpropanamide. InChIKey: DUSLEHJSBPZZFH-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO3 |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | 3-chloro-N-(3,5-dimethoxyphenyl)-2,2-dimethylpropanamide |
| InChIKey | DUSLEHJSBPZZFH-UHFFFAOYSA-N |
| SMILES | CC(C)(CCl)C(=O)NC1=CC(=CC(=C1)OC)OC |
Computed by PubChem (NCBI)