Products 4547-57-3
CAS 4547-57-3 appears in our catalog under these names: (4-n-Butoxyphenyl)acetic acid, 97%, 2-(4-Butoxyphenyl)acetic Acid, 4-Butoxyphenylacetic Acid, >98.0%(GC)(T), 4-(N-Butoxy)phenyl acetic acid, 2-(4-Butoxyphenyl)acetic acid 97%. Offered by: Combi-blocks, Mikromol, TCI, Biosynth, Ambeed. Available pack sizes: 25g, 100g, 5g, 1g, 25mg, 100mg, 2g, 10g.
2-(4-butoxyphenyl)acetic acid (CAS 4547-57-3) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 2-(4-butoxyphenyl)acetic acid. InChIKey: KLJMYYFCWBVKEE-UHFFFAOYSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 2-(4-butoxyphenyl)acetic acid |
| InChIKey | KLJMYYFCWBVKEE-UHFFFAOYSA-N |
| SMILES | CCCCOC1=CC=C(C=C1)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Butoxyphenylacetic acid, 4-n-Butoxyphenylacetic acid, Benzeneacetic acid, 4-butoxy-, Acetic acid, (p-butoxyphenyl)-, p-Butoxyphenylacetic acid, 4-Butoxybenzeneacetic acid, (p-Butoxyphenyl)acetic acid, BENZENEACETIC ACID, P-BUTOXY-, Benzeneacetic acid, 4-butoxy-(9CI), 2-(4-butoxyphenyl)acetic acid