Products 455-75-4
CAS 455-75-4 appears in our catalog under these names: Ethyl 3-amino-4-fluorobenzoate 95%, Ethyl 3-Amino-4-fluorobenzoate, 97%, 3-Amino-4-fluorobenzoic acid ethyl ester, Ethyl 3-amino-4-fluorobenzoate, 95%, 95%. Offered by: Ambeed, Fluorochem, Biosynth, Chemat. Available pack sizes: 5g, 25g, 10g, 50g, 100g, 1g.
Ethyl 3-amino-4-fluorobenzoate (CAS 455-75-4) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: ethyl 3-amino-4-fluorobenzoate. InChIKey: XRJOTWKQZHOXTM-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | ethyl 3-amino-4-fluorobenzoate |
| InChIKey | XRJOTWKQZHOXTM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C=C1)F)N |
Computed by PubChem (NCBI)