CAS 455323-66-7 appears in our catalog under these names: Methyl 4-(piperidin-4-yloxy)benzoate hydrochloride, 97%, Methyl 4-(piperidin-4-yloxy)benzoate hydrochloride, 97%, 97%, Methyl 4-(piperidin-4-yloxy)benzoate hydrochloride. Offered by: AmBeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, Get quote.
Methyl 4-piperidin-4-yloxybenzoate;hydrochloride (CAS 455323-66-7) is a chemical compound with the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. IUPAC name: methyl 4-piperidin-4-yloxybenzoate;hydrochloride. InChIKey: VRLHTHGGZZAAST-UHFFFAOYSA-N.
| Molecular formula | C13H18ClNO3 |
|---|---|
| Molecular weight | 271.74 g/mol |
| IUPAC name | methyl 4-piperidin-4-yloxybenzoate;hydrochloride |
| InChIKey | VRLHTHGGZZAAST-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)OC2CCNCC2.Cl |
Computed by PubChem (NCBI)