CAS 4584-63-8 appears in our catalog under these names: 2,5–Di–tert–pentylcyclohexa–2,5–diene–1,4–dione, 2,5-Di-tert-amylbenzoquinone, 2,5-Di-tert-amylbenzoquinone, >95.0%(GC), 2,5-Di-tert-pentylcyclohexa-2,5-diene-1,4-dione 95%, 2,5-Di-tert-pentylcyclohexa-2,5-diene-1,4-dione, 95%, 95%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg.
2,5-bis(2-methylbutan-2-yl)cyclohexa-2,5-diene-1,4-dione (CAS 4584-63-8) is a chemical compound with the molecular formula C16H24O2 and a molecular weight of 248.36 g/mol. IUPAC name: 2,5-bis(2-methylbutan-2-yl)cyclohexa-2,5-diene-1,4-dione. InChIKey: DHXFOYLEDAOQRR-UHFFFAOYSA-N.
| Molecular formula | C16H24O2 |
|---|---|
| Molecular weight | 248.36 g/mol |
| IUPAC name | 2,5-bis(2-methylbutan-2-yl)cyclohexa-2,5-diene-1,4-dione |
| InChIKey | DHXFOYLEDAOQRR-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)C1=CC(=O)C(=CC1=O)C(C)(C)CC |
Computed by PubChem (NCBI)