CAS 459796-19-1 appears in our catalog under these names: 2-Cyclopropylquinazolin-4(3h)-one, 95%, 2-cyclopropylquinazolin-4(3h)-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 2,5g.
2-cyclopropyl-3H-quinazolin-4-one (CAS 459796-19-1) is a chemical compound with the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. IUPAC name: 2-cyclopropyl-3H-quinazolin-4-one. InChIKey: YXPNOKUONQBBIE-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O |
|---|---|
| Molecular weight | 186.21 g/mol |
| IUPAC name | 2-cyclopropyl-3H-quinazolin-4-one |
| InChIKey | YXPNOKUONQBBIE-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC3=CC=CC=C3C(=O)N2 |
Computed by PubChem (NCBI)