CAS 46006-36-4 appears in our catalog under these names: Benzimidazole–4–carboxylic acid, Benzimidazole-4-carboxylic acid, 1H-Benzimidazole-4-carboxylic acid, 97%, 1H-Benzimidazole-7-carboxylic acid 98%. Offered by: GLPBio, Biosynth, Thermo Scientific (Acros), Fluorochem, Ambeed. Available pack sizes: 1g, 25g, 5g, 2g, 10g, 250mg, 50g, 100g.
1H-benzimidazole-4-carboxylic acid (CAS 46006-36-4) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 1H-benzimidazole-4-carboxylic acid. InChIKey: VVQNAFBGAWCMLU-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 1H-benzimidazole-4-carboxylic acid |
| InChIKey | VVQNAFBGAWCMLU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)NC=N2)C(=O)O |
Computed by PubChem (NCBI)