Products 460365-08-6

CAS 460365-08-6 is the registry number for 1(2H)-Pyridinecarboxylic acid, 4-(4-cyanophenyl)-3,6-dihydro-, 1,1-dimethylethyl ester, 95%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-(4-cyanophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate (CAS 460365-08-6) is a chemical compound with the molecular formula C17H20N2O2 and a molecular weight of 284.35 g/mol. IUPAC name: tert-butyl 4-(4-cyanophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate. InChIKey: XORFIANJCRWDRD-UHFFFAOYSA-N.

Identity
Molecular formulaC17H20N2O2
Molecular weight284.35 g/mol
IUPAC nametert-butyl 4-(4-cyanophenyl)-3,6-dihydro-2H-pyridine-1-carboxylate
InChIKeyXORFIANJCRWDRD-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(=CC1)C2=CC=C(C=C2)C#N

Computed by PubChem (NCBI)