CAS 461424-21-5 appears in our catalog under these names: IDO1/TDO–IN–4, IDO1/TDO-IN-4, 98%, IDO1/TDO-IN-4, IDO1/TDO-IN-4 98%, 1-(1H-Imidazol-5-yl)-9H-pyrido[3,4-b]indole. Offered by: GLPBio, AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 2mg, 10mg, 100mg, 25mg, 50mg, 250mg, 1mg.
1-(1H-imidazol-5-yl)-9H-pyrido[3,4-b]indole (CAS 461424-21-5) is a chemical compound with the molecular formula C14H10N4 and a molecular weight of 234.26 g/mol. IUPAC name: 1-(1H-imidazol-5-yl)-9H-pyrido[3,4-b]indole. InChIKey: HUTBKGSJEGKJBG-UHFFFAOYSA-N.
| Molecular formula | C14H10N4 |
|---|---|
| Molecular weight | 234.26 g/mol |
| IUPAC name | 1-(1H-imidazol-5-yl)-9H-pyrido[3,4-b]indole |
| InChIKey | HUTBKGSJEGKJBG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C(=NC=C3)C4=CN=CN4 |
Computed by PubChem (NCBI)