CAS 501935-96-2 appears in our catalog under these names: CTX1, CTX1, 97.02%, 97.02%, CTX1, 98.50%. Offered by: Chemat Brand, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: on request, 1mg, 10mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg, 1 mg.
3,6-diaminoacridine-9-carbonitrile (CAS 501935-96-2) is a chemical compound with the molecular formula C14H10N4 and a molecular weight of 234.26 g/mol. IUPAC name: 3,6-diaminoacridine-9-carbonitrile. InChIKey: PUMGFEMNXBLDKD-UHFFFAOYSA-N.
| Molecular formula | C14H10N4 |
|---|---|
| Molecular weight | 234.26 g/mol |
| IUPAC name | 3,6-diaminoacridine-9-carbonitrile |
| InChIKey | PUMGFEMNXBLDKD-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)N=C3C=C(C=CC3=C2C#N)N |
Computed by PubChem (NCBI)