Products 6830-78-0
CAS 6830-78-0 appears in our catalog under these names: 3,6-Diphenyl-1,2,4,5-tetrazine, 95%, 3,6-Diphenyl-1,2,4,5-tetrazine, >95% (HPLC), 3,6–Diphenyl–1,2,4,5–tetrazine, 3,6-Diphenyl-1,2,4,5-tetrazine, >98.0%(qNMR), 3,6-Diphenyl-1,2,4,5-tetrazine 97%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Ambeed. Available pack sizes: 5g, 1g, 100mg, 10mg, 50mg, 200mg, 250mg, 10g.
3,6-diphenyl-1,2,4,5-tetrazine (CAS 6830-78-0) is a chemical compound with the molecular formula C14H10N4 and a molecular weight of 234.26 g/mol. IUPAC name: 3,6-diphenyl-1,2,4,5-tetrazine. InChIKey: XAUWSIIGUUMHQQ-UHFFFAOYSA-N.
| Molecular formula | C14H10N4 |
|---|---|
| Molecular weight | 234.26 g/mol |
| IUPAC name | 3,6-diphenyl-1,2,4,5-tetrazine |
| InChIKey | XAUWSIIGUUMHQQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(N=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)