CAS 46187-37-5 appears in our catalog under these names: 2-Isobutyl-3,5,6-trimethylpyrazine, 95%, 2–Isobutyl–3,5,6–trimethylpyrazine, 2-Isobutyl-3,5,6-trimethylpyrazine, 97%, 97%, 2-Isobutyl-3,5,6-trimethylpyrazine, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
2,3,5-trimethyl-6-(2-methylpropyl)pyrazine (CAS 46187-37-5) is a chemical compound with the molecular formula C11H18N2 and a molecular weight of 178.27 g/mol. IUPAC name: 2,3,5-trimethyl-6-(2-methylpropyl)pyrazine. InChIKey: CMCOFWHSAGPVSF-UHFFFAOYSA-N.
| Molecular formula | C11H18N2 |
|---|---|
| Molecular weight | 178.27 g/mol |
| IUPAC name | 2,3,5-trimethyl-6-(2-methylpropyl)pyrazine |
| InChIKey | CMCOFWHSAGPVSF-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(C(=N1)C)CC(C)C)C |
Computed by PubChem (NCBI)