CAS 46413-67-6 appears in our catalog under these names: 5-(4-Methylphenyl)-2H-pyrazole-3-carboxylic acid, 98%, 5-(p-Tolyl)-1H-pyrazole-3-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 100g, 5g, 1g.
3-(4-methylphenyl)-1H-pyrazole-5-carboxylic acid (CAS 46413-67-6) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: 3-(4-methylphenyl)-1H-pyrazole-5-carboxylic acid. InChIKey: BGTWUOQARPOYER-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 3-(4-methylphenyl)-1H-pyrazole-5-carboxylic acid |
| InChIKey | BGTWUOQARPOYER-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NNC(=C2)C(=O)O |
Computed by PubChem (NCBI)