CAS 465542-64-7 is the registry number for Methyl 4-oxo-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine-7-carboxylate. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
Methyl 4-oxo-1,2,3,5-tetrahydro-1,5-benzodiazepine-7-carboxylate (CAS 465542-64-7) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: methyl 4-oxo-1,2,3,5-tetrahydro-1,5-benzodiazepine-7-carboxylate. InChIKey: UHEOWHQPWJQSBO-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O3 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | methyl 4-oxo-1,2,3,5-tetrahydro-1,5-benzodiazepine-7-carboxylate |
| InChIKey | UHEOWHQPWJQSBO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)NCCC(=O)N2 |
Computed by PubChem (NCBI)